C28H37N5O9S2 — CID 59028858
tert-butyl N-[[5-[(3,4-dimethoxyphenyl)sulfonylamino]-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate (PubChem CID 59028858) has the molecular formula C28H37N5O9S2 and a molecular weight of 651.76 g/mol. Its IUPAC name is tert-butyl N-[[5-[(3,4-dimethoxyphenyl)sulfonylamino]-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[5-[(3,4-dimethoxyphenyl)sulfonylamino]-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 59028858 |
| Molecular Formula | C28H37N5O9S2 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | tert-butyl N-[[5-[(3,4-dimethoxyphenyl)sulfonylamino]-6-oxo-6-(quinolin-8-ylamino)hexyl]sulfamoyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)NC(CCCCNS(=O)(=O)NC(=O)OC(C)(C)C)C(=O)Nc2cccc3cccnc23)cc1OC |
| InChI | InChI=1S/C28H37N5O9S2/c1-28(2,3)42-27(35)33-44(38,39)30-17-7-6-12-22(26(34)31-21-13-8-10-19-11-9-16-29-25(19)21)32-43(36,37)20-14-15-23(40-4)24(18-20)41-5/h8-11,13-16,18,22,30,32H,6-7,12,17H2,1-5H3,(H,31,34)(H,33,35) |
| InChIKey | XPOBBUJIKWVNPX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 191.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|