C14H22N2O6S — CID 69227886
(2S)-6-amino-2-[(3,4-dimethoxyphenyl)sulfonylamino]hexanoic acid (PubChem CID 69227886) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S)-6-amino-2-[(3,4-dimethoxyphenyl)sulfonylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(3,4-dimethoxyphenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 69227886 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2S)-6-amino-2-[(3,4-dimethoxyphenyl)sulfonylamino]hexanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(=O)O)cc1OC |
| InChI | InChI=1S/C14H22N2O6S/c1-21-12-7-6-10(9-13(12)22-2)23(19,20)16-11(14(17)18)5-3-4-8-15/h6-7,9,11,16H,3-5,8,15H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | PWVMLQYIHLNFQR-NSHDSACASA-N |
| XLogP | 0.56 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|