C17H25NO8S — CID 6735010
diethyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]pentanedioate (PubChem CID 6735010) has the molecular formula C17H25NO8S and a molecular weight of 403.45 g/mol. Its IUPAC name is diethyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]pentanedioate.
| Compound Name | diethyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 6735010 |
| Molecular Formula | C17H25NO8S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | diethyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]pentanedioate |
| SMILES | CCOC(=O)CCC(NS(=O)(=O)c1ccc(OC)c(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C17H25NO8S/c1-5-25-16(19)10-8-13(17(20)26-6-2)18-27(21,22)12-7-9-14(23-3)15(11-12)24-4/h7,9,11,13,18H,5-6,8,10H2,1-4H3 |
| InChIKey | MVCNXAGQDDJITE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |