C11H16N2O6S — CID 26970116
ethyl N-[(3,4-dimethoxyphenyl)sulfonylamino]carbamate (PubChem CID 26970116) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is ethyl N-[(3,4-dimethoxyphenyl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(3,4-dimethoxyphenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 26970116 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | ethyl N-[(3,4-dimethoxyphenyl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H16N2O6S/c1-4-19-11(14)12-13-20(15,16)8-5-6-9(17-2)10(7-8)18-3/h5-7,13H,4H2,1-3H3,(H,12,14) |
| InChIKey | STRYGPTVXOGAQY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|