C13H17N3O6S — CID 8841330
N-cyclopropyl-2-[2-(3,4-dimethoxyphenyl)sulfonylhydrazinyl]-2-oxoacetamide (PubChem CID 8841330) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(3,4-dimethoxyphenyl)sulfonylhydrazinyl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[2-(3,4-dimethoxyphenyl)sulfonylhydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 8841330 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-cyclopropyl-2-[2-(3,4-dimethoxyphenyl)sulfonylhydrazinyl]-2-oxoacetamide |
| SMILES | COc1ccc(S(=O)(=O)NNC(=O)C(=O)NC2CC2)cc1OC |
| InChI | InChI=1S/C13H17N3O6S/c1-21-10-6-5-9(7-11(10)22-2)23(19,20)16-15-13(18)12(17)14-8-3-4-8/h5-8,16H,3-4H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | FORZTHRNDWLJAX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|