C11H11Cl2N3O4S — CID 8841266
N-cyclopropyl-2-[2-(3,5-dichlorophenyl)sulfonylhydrazinyl]-2-oxoacetamide (PubChem CID 8841266) has the molecular formula C11H11Cl2N3O4S and a molecular weight of 352.20 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(3,5-dichlorophenyl)sulfonylhydrazinyl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[2-(3,5-dichlorophenyl)sulfonylhydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 8841266 |
| Molecular Formula | C11H11Cl2N3O4S |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | N-cyclopropyl-2-[2-(3,5-dichlorophenyl)sulfonylhydrazinyl]-2-oxoacetamide |
| SMILES | O=C(NNS(=O)(=O)c1cc(Cl)cc(Cl)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H11Cl2N3O4S/c12-6-3-7(13)5-9(4-6)21(19,20)16-15-11(18)10(17)14-8-1-2-8/h3-5,8,16H,1-2H2,(H,14,17)(H,15,18) |
| InChIKey | IJWFOSLOVLRRGL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|