C12H11ClF3N3O4S — CID 8841202
2-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylhydrazinyl]-N-cyclopropyl-2-oxoacetamide (PubChem CID 8841202) has the molecular formula C12H11ClF3N3O4S and a molecular weight of 385.75 g/mol. Its IUPAC name is 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylhydrazinyl]-N-cyclopropyl-2-oxoacetamide.
| Compound Name | 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylhydrazinyl]-N-cyclopropyl-2-oxoacetamide |
|---|---|
| PubChem CID | 8841202 |
| Molecular Formula | C12H11ClF3N3O4S |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylhydrazinyl]-N-cyclopropyl-2-oxoacetamide |
| SMILES | O=C(NNS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H11ClF3N3O4S/c13-8-4-1-6(12(14,15)16)5-9(8)24(22,23)19-18-11(21)10(20)17-7-2-3-7/h1,4-5,7,19H,2-3H2,(H,17,20)(H,18,21) |
| InChIKey | XEWTZUFLLZUMIC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|