C12H14ClF3N2O3S — CID 8802505
(2R)-2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-ethylpropanamide (PubChem CID 8802505) has the molecular formula C12H14ClF3N2O3S and a molecular weight of 358.77 g/mol. Its IUPAC name is (2R)-2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-ethylpropanamide.
| Compound Name | (2R)-2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 8802505 |
| Molecular Formula | C12H14ClF3N2O3S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (2R)-2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3S/c1-3-17-11(19)7(2)18-22(20,21)10-6-8(12(14,15)16)4-5-9(10)13/h4-7,18H,3H2,1-2H3,(H,17,19)/t7-/m1/s1 |
| InChIKey | LSFMKGWHAWAGEI-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |