C11H14ClFN2O3S — CID 8802546
(2R)-2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethylpropanamide (PubChem CID 8802546) has the molecular formula C11H14ClFN2O3S and a molecular weight of 308.76 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethylpropanamide.
| Compound Name | (2R)-2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 8802546 |
| Molecular Formula | C11H14ClFN2O3S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (2R)-2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)NS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClFN2O3S/c1-3-14-11(16)7(2)15-19(17,18)8-4-5-10(13)9(12)6-8/h4-7,15H,3H2,1-2H3,(H,14,16)/t7-/m1/s1 |
| InChIKey | JNXUHTPYVADMRV-SSDOTTSWSA-N |
| XLogP | 1.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |