C11H13F3N2O3S — CID 8802570
(2S)-N-ethyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanamide (PubChem CID 8802570) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-ethyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 8802570 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (2S)-N-ethyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanamide |
| SMILES | CCNC(=O)[C@H](C)NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H13F3N2O3S/c1-3-15-11(17)6(2)16-20(18,19)8-5-4-7(12)9(13)10(8)14/h4-6,16H,3H2,1-2H3,(H,15,17)/t6-/m0/s1 |
| InChIKey | XNSIISUJCAXRDL-LURJTMIESA-N |
| XLogP | 0.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|