C10H13F2N3O3S — CID 107343391
2-[(3-amino-2,4-difluorophenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 107343391) has the molecular formula C10H13F2N3O3S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(3-amino-2,4-difluorophenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | 2-[(3-amino-2,4-difluorophenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 107343391 |
| Molecular Formula | C10H13F2N3O3S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[(3-amino-2,4-difluorophenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NS(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C10H13F2N3O3S/c1-5(10(16)14-2)15-19(17,18)7-4-3-6(11)9(13)8(7)12/h3-5,15H,13H2,1-2H3,(H,14,16) |
| InChIKey | HPFISOKBOOXHFP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|