C14H12Cl2N2O3S — CID 8616766
N'-(3,5-dichlorophenyl)sulfonyl-4-methylbenzohydrazide (PubChem CID 8616766) has the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.23 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)sulfonyl-4-methylbenzohydrazide.
| Compound Name | N'-(3,5-dichlorophenyl)sulfonyl-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 8616766 |
| Molecular Formula | C14H12Cl2N2O3S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | N'-(3,5-dichlorophenyl)sulfonyl-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNS(=O)(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C14H12Cl2N2O3S/c1-9-2-4-10(5-3-9)14(19)17-18-22(20,21)13-7-11(15)6-12(16)8-13/h2-8,18H,1H3,(H,17,19) |
| InChIKey | BKYUDFIZVCLBQO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|