C17H19NO7S — CID 32939387
[3-(ethoxycarbonylamino)phenyl] 3,4-dimethoxybenzenesulfonate (PubChem CID 32939387) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] 3,4-dimethoxybenzenesulfonate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 32939387 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] 3,4-dimethoxybenzenesulfonate |
| SMILES | CCOC(=O)Nc1cccc(OS(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H19NO7S/c1-4-24-17(19)18-12-6-5-7-13(10-12)25-26(20,21)14-8-9-15(22-2)16(11-14)23-3/h5-11H,4H2,1-3H3,(H,18,19) |
| InChIKey | SVQHRKVAKOHPBS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|