C15H13F2NO5S — CID 39792626
[3-(ethoxycarbonylamino)phenyl] 2,5-difluorobenzenesulfonate (PubChem CID 39792626) has the molecular formula C15H13F2NO5S and a molecular weight of 357.33 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] 2,5-difluorobenzenesulfonate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] 2,5-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 39792626 |
| Molecular Formula | C15H13F2NO5S |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] 2,5-difluorobenzenesulfonate |
| SMILES | CCOC(=O)Nc1cccc(OS(=O)(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C15H13F2NO5S/c1-2-22-15(19)18-11-4-3-5-12(9-11)23-24(20,21)14-8-10(16)6-7-13(14)17/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | HVKOEBPJZFDQBK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|