C24H25N5O5S — CID 69451737
N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 69451737) has the molecular formula C24H25N5O5S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69451737 |
| Molecular Formula | C24H25N5O5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | NS(=O)(=O)NCCCCC(NC(=O)c1cc2ccccc2o1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C24H25N5O5S/c25-35(32,33)27-14-4-3-10-19(29-24(31)21-15-17-7-1-2-12-20(17)34-21)23(30)28-18-11-5-8-16-9-6-13-26-22(16)18/h1-2,5-9,11-13,15,19,27H,3-4,10,14H2,(H,28,30)(H,29,31)(H2,25,32,33) |
| InChIKey | KTCATEJSIZJENE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|