C31H29N3O5 — CID 141117128
N-[(4S)-4-(1-benzofuran-2-carbonylamino)-5-oxo-5-(2-phenylethylamino)pentyl]-1-benzofuran-2-carboxamide (PubChem CID 141117128) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[(4S)-4-(1-benzofuran-2-carbonylamino)-5-oxo-5-(2-phenylethylamino)pentyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(4S)-4-(1-benzofuran-2-carbonylamino)-5-oxo-5-(2-phenylethylamino)pentyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 141117128 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[(4S)-4-(1-benzofuran-2-carbonylamino)-5-oxo-5-(2-phenylethylamino)pentyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCC[C@H](NC(=O)c1cc2ccccc2o1)C(=O)NCCc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C31H29N3O5/c35-29(33-18-16-21-9-2-1-3-10-21)24(34-31(37)28-20-23-12-5-7-15-26(23)39-28)13-8-17-32-30(36)27-19-22-11-4-6-14-25(22)38-27/h1-7,9-12,14-15,19-20,24H,8,13,16-18H2,(H,32,36)(H,33,35)(H,34,37)/t24-/m0/s1 |
| InChIKey | SABWMWDQXCKCCT-DEOSSOPVSA-N |
| XLogP | 4.85 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|