C20H26N4O6 — CID 170376685
N-[(5S)-5-acetamido-6-[(1-amino-3-hydroxy-1-oxopropan-2-yl)amino]-6-oxohexyl]-1-benzofuran-2-carboxamide (PubChem CID 170376685) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[(5S)-5-acetamido-6-[(1-amino-3-hydroxy-1-oxopropan-2-yl)amino]-6-oxohexyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(5S)-5-acetamido-6-[(1-amino-3-hydroxy-1-oxopropan-2-yl)amino]-6-oxohexyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 170376685 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[(5S)-5-acetamido-6-[(1-amino-3-hydroxy-1-oxopropan-2-yl)amino]-6-oxohexyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)c1cc2ccccc2o1)C(=O)NC(CO)C(N)=O |
| InChI | InChI=1S/C20H26N4O6/c1-12(26)23-14(19(28)24-15(11-25)18(21)27)7-4-5-9-22-20(29)17-10-13-6-2-3-8-16(13)30-17/h2-3,6,8,10,14-15,25H,4-5,7,9,11H2,1H3,(H2,21,27)(H,22,29)(H,23,26)(H,24,28)/t14-,15?/m0/s1 |
| InChIKey | ARRCZCIJVHLLLA-MLCCFXAWSA-N |
| XLogP | -0.20 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|