C23H31N5O7 — CID 170376552
N-[(5S)-5-acetamido-6-[[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-6-oxohexyl]-1-benzofuran-2-carboxamide (PubChem CID 170376552) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-[(5S)-5-acetamido-6-[[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-6-oxohexyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(5S)-5-acetamido-6-[[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-6-oxohexyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 170376552 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(5S)-5-acetamido-6-[[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-6-oxohexyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)c1cc2ccccc2o1)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(N)=O |
| InChI | InChI=1S/C23H31N5O7/c1-13(20(24)31)26-22(33)17(12-29)28-21(32)16(27-14(2)30)8-5-6-10-25-23(34)19-11-15-7-3-4-9-18(15)35-19/h3-4,7,9,11,13,16-17,29H,5-6,8,10,12H2,1-2H3,(H2,24,31)(H,25,34)(H,26,33)(H,27,30)(H,28,32)/t13-,16-,17-/m0/s1 |
| InChIKey | SBWBJSVPYLMPAU-JQFCIGGWSA-N |
| XLogP | -0.70 |
| TPSA | 192.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|