C31H44N6O5S — CID 122186874
(2S)-2,6-diacetamido-N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-(ethanethioylamino)-1-oxohexan-2-yl]hexanamide (PubChem CID 122186874) has the molecular formula C31H44N6O5S and a molecular weight of 612.80 g/mol. Its IUPAC name is (2S)-2,6-diacetamido-N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-(ethanethioylamino)-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diacetamido-N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-(ethanethioylamino)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 122186874 |
| Molecular Formula | C31H44N6O5S |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | (2S)-2,6-diacetamido-N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-(ethanethioylamino)-1-oxohexan-2-yl]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)N[C@@H](CCCCNC(C)=S)C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C31H44N6O5S/c1-20(38)33-16-8-6-12-26(35-21(2)39)30(41)36-27(13-7-9-17-34-22(3)43)31(42)37-28(29(32)40)19-23-14-15-24-10-4-5-11-25(24)18-23/h4-5,10-11,14-15,18,26-28H,6-9,12-13,16-17,19H2,1-3H3,(H2,32,40)(H,33,38)(H,34,43)(H,35,39)(H,36,41)(H,37,42)/t26-,27-,28-/m0/s1 |
| InChIKey | DVLMHRUJBJIACR-KCHLEUMXSA-N |
| XLogP | 1.76 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|