C21H21N3O5 — CID 141117117
benzyl N-[(3S)-4-amino-3-(1-benzofuran-2-carbonylamino)-4-oxobutyl]carbamate (PubChem CID 141117117) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is benzyl N-[(3S)-4-amino-3-(1-benzofuran-2-carbonylamino)-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[(3S)-4-amino-3-(1-benzofuran-2-carbonylamino)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 141117117 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | benzyl N-[(3S)-4-amino-3-(1-benzofuran-2-carbonylamino)-4-oxobutyl]carbamate |
| SMILES | NC(=O)[C@H](CCNC(=O)OCc1ccccc1)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H21N3O5/c22-19(25)16(10-11-23-21(27)28-13-14-6-2-1-3-7-14)24-20(26)18-12-15-8-4-5-9-17(15)29-18/h1-9,12,16H,10-11,13H2,(H2,22,25)(H,23,27)(H,24,26)/t16-/m0/s1 |
| InChIKey | ZVKURQYFVFPTFT-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |