C25H29N5O5S — CID 69454007
N-[1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 69454007) has the molecular formula C25H29N5O5S and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69454007 |
| Molecular Formula | C25H29N5O5S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-6-(sulfamoylamino)hexan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | NS(=O)(=O)NCCCCC(NC(=O)c1cc2ccccc2o1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H29N5O5S/c26-36(33,34)29-13-6-5-10-21(30-25(32)23-15-17-7-1-4-11-22(17)35-23)24(31)27-14-12-18-16-28-20-9-3-2-8-19(18)20/h1-4,7-9,11,15-16,21,28-29H,5-6,10,12-14H2,(H,27,31)(H,30,32)(H2,26,33,34) |
| InChIKey | SDKUEUIZDRPQPY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 159.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|