C22H20N2O4 — CID 7094958
(2S)-N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide (PubChem CID 7094958) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2S)-N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide.
| Compound Name | (2S)-N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 7094958 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S)-N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide |
| SMILES | C[C@H](Oc1ccc2ccc(=O)oc2c1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N2O4/c1-14(27-17-8-6-15-7-9-21(25)28-20(15)12-17)22(26)23-11-10-16-13-24-19-5-3-2-4-18(16)19/h2-9,12-14,24H,10-11H2,1H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | NXHKTEWRXLFZBT-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|