C27H21FN2O4 — CID 134152051
7-[(2-fluorophenyl)methoxy]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 134152051) has the molecular formula C27H21FN2O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is 7-[(2-fluorophenyl)methoxy]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 7-[(2-fluorophenyl)methoxy]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 134152051 |
| Molecular Formula | C27H21FN2O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 7-[(2-fluorophenyl)methoxy]-N-[2-(1H-indol-3-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cc2ccc(OCc3ccccc3F)cc2oc1=O |
| InChI | InChI=1S/C27H21FN2O4/c28-23-7-3-1-5-19(23)16-33-20-10-9-17-13-22(27(32)34-25(17)14-20)26(31)29-12-11-18-15-30-24-8-4-2-6-21(18)24/h1-10,13-15,30H,11-12,16H2,(H,29,31) |
| InChIKey | YIGYSVTZTGHTLM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|