C20H18FNO4 — CID 7564685
(2R)-N-[2-(4-fluorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide (PubChem CID 7564685) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is (2R)-N-[2-(4-fluorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide.
| Compound Name | (2R)-N-[2-(4-fluorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 7564685 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (2R)-N-[2-(4-fluorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxypropanamide |
| SMILES | C[C@@H](Oc1ccc2ccc(=O)oc2c1)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FNO4/c1-13(20(24)22-11-10-14-2-6-16(21)7-3-14)25-17-8-4-15-5-9-19(23)26-18(15)12-17/h2-9,12-13H,10-11H2,1H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | BZRYTQKMPGCUQP-CYBMUJFWSA-N |
| XLogP | 3.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|