C32H34N4O5 — CID 11953063
benzyl N-[(2S)-1-oxo-6-[(2-phenylmethoxyacetyl)amino]-1-(quinolin-8-ylamino)hexan-2-yl]carbamate (PubChem CID 11953063) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-6-[(2-phenylmethoxyacetyl)amino]-1-(quinolin-8-ylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-6-[(2-phenylmethoxyacetyl)amino]-1-(quinolin-8-ylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11953063 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-6-[(2-phenylmethoxyacetyl)amino]-1-(quinolin-8-ylamino)hexan-2-yl]carbamate |
| SMILES | O=C(COCc1ccccc1)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C32H34N4O5/c37-29(23-40-21-24-11-3-1-4-12-24)33-19-8-7-17-28(36-32(39)41-22-25-13-5-2-6-14-25)31(38)35-27-18-9-15-26-16-10-20-34-30(26)27/h1-6,9-16,18,20,28H,7-8,17,19,21-23H2,(H,33,37)(H,35,38)(H,36,39)/t28-/m0/s1 |
| InChIKey | WMZUYMIYRBEMAR-NDEPHWFRSA-N |
| XLogP | 4.97 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|