C31H35N5O4S — CID 143299225
cyclohexa-1,5-dien-1-ylmethyl N-[(2R)-6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1-oxo-1-(quinolin-8-ylamino)hexan-2-yl]carbamate (PubChem CID 143299225) has the molecular formula C31H35N5O4S and a molecular weight of 573.72 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-[(2R)-6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1-oxo-1-(quinolin-8-ylamino)hexan-2-yl]carbamate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-[(2R)-6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1-oxo-1-(quinolin-8-ylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 143299225 |
| Molecular Formula | C31H35N5O4S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-[(2R)-6-[[2-(4-aminophenyl)sulfanylacetyl]amino]-1-oxo-1-(quinolin-8-ylamino)hexan-2-yl]carbamate |
| SMILES | Nc1ccc(SCC(=O)NCCCC[C@@H](NC(=O)OCC2=CCCC=C2)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C31H35N5O4S/c32-24-14-16-25(17-15-24)41-21-28(37)33-18-5-4-12-27(36-31(39)40-20-22-8-2-1-3-9-22)30(38)35-26-13-6-10-23-11-7-19-34-29(23)26/h2,6-11,13-17,19,27H,1,3-5,12,18,20-21,32H2,(H,33,37)(H,35,38)(H,36,39)/t27-/m1/s1 |
| InChIKey | PVJCAJKPOGCTLY-HHHXNRCGSA-N |
| XLogP | 5.21 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|