C25H29N7O6 — CID 10625863
benzyl N-[1-[(5-carbamoyl-2H-triazol-4-yl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 10625863) has the molecular formula C25H29N7O6 and a molecular weight of 523.55 g/mol. Its IUPAC name is benzyl N-[1-[(5-carbamoyl-2H-triazol-4-yl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(5-carbamoyl-2H-triazol-4-yl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 10625863 |
| Molecular Formula | C25H29N7O6 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | benzyl N-[1-[(5-carbamoyl-2H-triazol-4-yl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | NC(=O)c1n[nH]nc1NC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29N7O6/c26-21(33)20-22(31-32-30-20)29-23(34)19(28-25(36)38-16-18-11-5-2-6-12-18)13-7-8-14-27-24(35)37-15-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16H2,(H2,26,33)(H,27,35)(H,28,36)(H2,29,30,31,32,34) |
| InChIKey | DWEYVLBSOGTWBD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 190.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|