C51H45N3O6 — CID 101243996
benzyl N-[(2S)-1-oxo-1-[4-(3-oxo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)anilino]-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 101243996) has the molecular formula C51H45N3O6 and a molecular weight of 795.94 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-[4-(3-oxo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)anilino]-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-[4-(3-oxo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)anilino]-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 101243996 |
| Molecular Formula | C51H45N3O6 |
| Molecular Weight | 795.94 g/mol |
| Exact Mass | 795.33 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-[4-(3-oxo-2,4,5-triphenylcyclopenta-1,4-dien-1-yl)anilino]-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | O=C(NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccc(C2=C(c3ccccc3)C(=O)C(c3ccccc3)=C2c2ccccc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C51H45N3O6/c55-48-46(39-24-12-4-13-25-39)44(38-22-10-3-11-23-38)45(47(48)40-26-14-5-15-27-40)41-29-31-42(32-30-41)53-49(56)43(54-51(58)60-35-37-20-8-2-9-21-37)28-16-17-33-52-50(57)59-34-36-18-6-1-7-19-36/h1-15,18-27,29-32,43H,16-17,28,33-35H2,(H,52,57)(H,53,56)(H,54,58)/t43-/m0/s1 |
| InChIKey | DHSAYSABBZDSPZ-QLKFWGTOSA-N |
| XLogP | 10.12 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.94 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|