C30H33N3O6 — CID 70792386
benzyl N-[(2S)-1-(4-acetylanilino)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 70792386) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4-acetylanilino)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4-acetylanilino)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 70792386 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | benzyl N-[(2S)-1-(4-acetylanilino)-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@H](CCCCNC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N3O6/c1-22(34)25-15-17-26(18-16-25)32-28(35)27(33-30(37)39-21-24-12-6-3-7-13-24)14-8-9-19-31-29(36)38-20-23-10-4-2-5-11-23/h2-7,10-13,15-18,27H,8-9,14,19-21H2,1H3,(H,31,36)(H,32,35)(H,33,37)/t27-/m0/s1 |
| InChIKey | RGKKGLSAQDCVGG-MHZLTWQESA-N |
| XLogP | 5.22 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|