C24H30N4O6 — CID 121329551
3-[[(5S)-6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamoylamino]propanoic acid (PubChem CID 121329551) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 3-[[(5S)-6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[(5S)-6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 121329551 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3-[[(5S)-6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H30N4O6/c29-21(30)14-16-26-23(32)25-15-8-7-13-20(22(31)27-19-11-5-2-6-12-19)28-24(33)34-17-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,27,31)(H,28,33)(H,29,30)(H2,25,26,32)/t20-/m0/s1 |
| InChIKey | IOXVOUAZGAUEJN-FQEVSTJZSA-N |
| XLogP | 2.86 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|