C29H39N3O5S — CID 144755210
5-[[6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-2,2,4,4-tetramethyl-5-sulfanylidenepentanoic acid (PubChem CID 144755210) has the molecular formula C29H39N3O5S and a molecular weight of 541.71 g/mol. Its IUPAC name is 5-[[6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-2,2,4,4-tetramethyl-5-sulfanylidenepentanoic acid.
| Compound Name | 5-[[6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-2,2,4,4-tetramethyl-5-sulfanylidenepentanoic acid |
|---|---|
| PubChem CID | 144755210 |
| Molecular Formula | C29H39N3O5S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 5-[[6-anilino-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]amino]-2,2,4,4-tetramethyl-5-sulfanylidenepentanoic acid |
| SMILES | CC(C)(CC(C)(C)C(=S)NCCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H39N3O5S/c1-28(2,20-29(3,4)26(34)35)25(38)30-18-12-11-17-23(24(33)31-22-15-9-6-10-16-22)32-27(36)37-19-21-13-7-5-8-14-21/h5-10,13-16,23H,11-12,17-20H2,1-4H3,(H,30,38)(H,31,33)(H,32,36)(H,34,35) |
| InChIKey | RMLPIGOEIICJAD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|