C23H25FN4O5S — CID 71148112
8-[[(2S)-2-[(4-fluorophenyl)methoxycarbonylamino]-6-(sulfinoamino)hexanoyl]amino]quinoline (PubChem CID 71148112) has the molecular formula C23H25FN4O5S and a molecular weight of 488.54 g/mol. Its IUPAC name is 8-[[(2S)-2-[(4-fluorophenyl)methoxycarbonylamino]-6-(sulfinoamino)hexanoyl]amino]quinoline.
| Compound Name | 8-[[(2S)-2-[(4-fluorophenyl)methoxycarbonylamino]-6-(sulfinoamino)hexanoyl]amino]quinoline |
|---|---|
| PubChem CID | 71148112 |
| Molecular Formula | C23H25FN4O5S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 8-[[(2S)-2-[(4-fluorophenyl)methoxycarbonylamino]-6-(sulfinoamino)hexanoyl]amino]quinoline |
| SMILES | O=C(N[C@@H](CCCCNS(=O)O)C(=O)Nc1cccc2cccnc12)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O5S/c24-18-11-9-16(10-12-18)15-33-23(30)28-20(7-1-2-14-26-34(31)32)22(29)27-19-8-3-5-17-6-4-13-25-21(17)19/h3-6,8-13,20,26H,1-2,7,14-15H2,(H,27,29)(H,28,30)(H,31,32)/t20-/m0/s1 |
| InChIKey | WGRBYZIUJFPUPJ-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|