C25H26N6O4S — CID 59028912
N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]quinoline-8-carboxamide (PubChem CID 59028912) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]quinoline-8-carboxamide.
| Compound Name | N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 59028912 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[1-oxo-1-(quinolin-8-ylamino)-6-(sulfamoylamino)hexan-2-yl]quinoline-8-carboxamide |
| SMILES | NS(=O)(=O)NCCCCC(NC(=O)c1cccc2cccnc12)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C25H26N6O4S/c26-36(34,35)29-16-2-1-12-21(25(33)30-20-13-4-8-18-10-6-15-28-23(18)20)31-24(32)19-11-3-7-17-9-5-14-27-22(17)19/h3-11,13-15,21,29H,1-2,12,16H2,(H,30,33)(H,31,32)(H2,26,34,35) |
| InChIKey | KHARKPBMXGACGF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|