C26H30N6O2S — CID 143592817
N-[6-(aminosulfanylamino)hexan-2-yl]quinoline-8-carboxamide;N-quinolin-8-ylformamide (PubChem CID 143592817) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[6-(aminosulfanylamino)hexan-2-yl]quinoline-8-carboxamide;N-quinolin-8-ylformamide.
| Compound Name | N-[6-(aminosulfanylamino)hexan-2-yl]quinoline-8-carboxamide;N-quinolin-8-ylformamide |
|---|---|
| PubChem CID | 143592817 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[6-(aminosulfanylamino)hexan-2-yl]quinoline-8-carboxamide;N-quinolin-8-ylformamide |
| SMILES | CC(CCCCNSN)NC(=O)c1cccc2cccnc12.O=CNc1cccc2cccnc12 |
| InChI | InChI=1S/C16H22N4OS.C10H8N2O/c1-12(6-2-3-11-19-22-17)20-16(21)14-9-4-7-13-8-5-10-18-15(13)14;13-7-12-9-5-1-3-8-4-2-6-11-10(8)9/h4-5,7-10,12,19H,2-3,6,11,17H2,1H3,(H,20,21);1-7H,(H,12,13) |
| InChIKey | DCFVAHIRIRDCBR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|