C25H30N6O2S — CID 143592967
N-[6-(aminosulfanylamino)-1-oxohexan-2-yl]-1H-indole-6-carboxamide;N-methylquinolin-8-amine (PubChem CID 143592967) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-[6-(aminosulfanylamino)-1-oxohexan-2-yl]-1H-indole-6-carboxamide;N-methylquinolin-8-amine.
| Compound Name | N-[6-(aminosulfanylamino)-1-oxohexan-2-yl]-1H-indole-6-carboxamide;N-methylquinolin-8-amine |
|---|---|
| PubChem CID | 143592967 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[6-(aminosulfanylamino)-1-oxohexan-2-yl]-1H-indole-6-carboxamide;N-methylquinolin-8-amine |
| SMILES | CNc1cccc2cccnc12.NSNCCCCC(C=O)NC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C15H20N4O2S.C10H10N2/c16-22-18-7-2-1-3-13(10-20)19-15(21)12-5-4-11-6-8-17-14(11)9-12;1-11-9-6-2-4-8-5-3-7-12-10(8)9/h4-6,8-10,13,17-18H,1-3,7,16H2,(H,19,21);2-7,11H,1H3 |
| InChIKey | JFIJXCKKFWLISU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|