C26H24ClN3O2 — CID 144901091
2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-quinolin-5-ylformamide (PubChem CID 144901091) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-quinolin-5-ylformamide.
| Compound Name | 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-quinolin-5-ylformamide |
|---|---|
| PubChem CID | 144901091 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-quinolin-5-ylformamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccccc1Cl.O=CNc1cccc2ncccc12 |
| InChI | InChI=1S/C16H16ClNO.C10H8N2O/c1-12(11-13-7-3-2-4-8-13)18-16(19)14-9-5-6-10-15(14)17;13-7-12-10-5-1-4-9-8(10)3-2-6-11-9/h2-10,12H,11H2,1H3,(H,18,19);1-7H,(H,12,13) |
| InChIKey | IVIHYVNZNUSJAT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|