C24H23ClF2N2O3 — CID 144900997
2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-[2-(difluoromethoxy)phenyl]formamide (PubChem CID 144900997) has the molecular formula C24H23ClF2N2O3 and a molecular weight of 460.91 g/mol. Its IUPAC name is 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-[2-(difluoromethoxy)phenyl]formamide.
| Compound Name | 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-[2-(difluoromethoxy)phenyl]formamide |
|---|---|
| PubChem CID | 144900997 |
| Molecular Formula | C24H23ClF2N2O3 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-chloro-N-(1-phenylpropan-2-yl)benzamide;N-[2-(difluoromethoxy)phenyl]formamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccccc1Cl.O=CNc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H16ClNO.C8H7F2NO2/c1-12(11-13-7-3-2-4-8-13)18-16(19)14-9-5-6-10-15(14)17;9-8(10)13-7-4-2-1-3-6(7)11-5-12/h2-10,12H,11H2,1H3,(H,18,19);1-5,8H,(H,11,12) |
| InChIKey | JIGVYLYZZAXZNI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|