C16H26ClN3O3 — CID 142644170
butyl N-[1-oxo-1-(pyridin-2-ylamino)hexan-2-yl]carbamate;hydrochloride (PubChem CID 142644170) has the molecular formula C16H26ClN3O3 and a molecular weight of 343.86 g/mol. Its IUPAC name is butyl N-[1-oxo-1-(pyridin-2-ylamino)hexan-2-yl]carbamate;hydrochloride.
| Compound Name | butyl N-[1-oxo-1-(pyridin-2-ylamino)hexan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 142644170 |
| Molecular Formula | C16H26ClN3O3 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | butyl N-[1-oxo-1-(pyridin-2-ylamino)hexan-2-yl]carbamate;hydrochloride |
| SMILES | CCCCOC(=O)NC(CCCC)C(=O)Nc1ccccn1.Cl |
| InChI | InChI=1S/C16H25N3O3.ClH/c1-3-5-9-13(18-16(21)22-12-6-4-2)15(20)19-14-10-7-8-11-17-14;/h7-8,10-11,13H,3-6,9,12H2,1-2H3,(H,18,21)(H,17,19,20);1H |
| InChIKey | NVJKZEBQOBMRKR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|