C15H22BrN3O3 — CID 172825180
butyl N-[1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 172825180) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is butyl N-[1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | butyl N-[1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 172825180 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | butyl N-[1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(C(=O)Nc1cccc(Br)n1)C(C)C |
| InChI | InChI=1S/C15H22BrN3O3/c1-4-5-9-22-15(21)19-13(10(2)3)14(20)18-12-8-6-7-11(16)17-12/h6-8,10,13H,4-5,9H2,1-3H3,(H,19,21)(H,17,18,20) |
| InChIKey | UTMUIGPBPIHGRO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|