C20H21BrN6O3 — CID 130299896
1-[2-[[(2R)-1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]indazole-3-carboxamide (PubChem CID 130299896) has the molecular formula C20H21BrN6O3 and a molecular weight of 473.33 g/mol. Its IUPAC name is 1-[2-[[(2R)-1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]indazole-3-carboxamide.
| Compound Name | 1-[2-[[(2R)-1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 130299896 |
| Molecular Formula | C20H21BrN6O3 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-[2-[[(2R)-1-[(6-bromo-2-pyridinyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]indazole-3-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)Cn1nc(C(N)=O)c2ccccc21)C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C20H21BrN6O3/c1-11(2)17(20(30)24-15-9-5-8-14(21)23-15)25-16(28)10-27-13-7-4-3-6-12(13)18(26-27)19(22)29/h3-9,11,17H,10H2,1-2H3,(H2,22,29)(H,25,28)(H,23,24,30)/t17-/m1/s1 |
| InChIKey | GQELLUCCHCAQER-QGZVFWFLSA-N |
| XLogP | 2.07 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|