C17H22N4O4 — CID 130300102
tert-butyl 2-[[2-(3-carbamoylindazol-1-yl)acetyl]amino]propanoate (PubChem CID 130300102) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is tert-butyl 2-[[2-(3-carbamoylindazol-1-yl)acetyl]amino]propanoate.
| Compound Name | tert-butyl 2-[[2-(3-carbamoylindazol-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 130300102 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | tert-butyl 2-[[2-(3-carbamoylindazol-1-yl)acetyl]amino]propanoate |
| SMILES | CC(NC(=O)Cn1nc(C(N)=O)c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22N4O4/c1-10(16(24)25-17(2,3)4)19-13(22)9-21-12-8-6-5-7-11(12)14(20-21)15(18)23/h5-8,10H,9H2,1-4H3,(H2,18,23)(H,19,22) |
| InChIKey | AVVHGPSVWAFATN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |