C9H13BrClN3O — CID 126623961
2-amino-N-(6-bromo-2-pyridinyl)butanamide;hydrochloride (PubChem CID 126623961) has the molecular formula C9H13BrClN3O and a molecular weight of 294.58 g/mol. Its IUPAC name is 2-amino-N-(6-bromo-2-pyridinyl)butanamide;hydrochloride.
| Compound Name | 2-amino-N-(6-bromo-2-pyridinyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 126623961 |
| Molecular Formula | C9H13BrClN3O |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-amino-N-(6-bromo-2-pyridinyl)butanamide;hydrochloride |
| SMILES | CCC(N)C(=O)Nc1cccc(Br)n1.Cl |
| InChI | InChI=1S/C9H12BrN3O.ClH/c1-2-6(11)9(14)13-8-5-3-4-7(10)12-8;/h3-6H,2,11H2,1H3,(H,12,13,14);1H |
| InChIKey | AKWGQXGGXPUPLT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|