C23H44N2O5 — CID 91729869
4-methylpentyl 2-[2-(butoxycarbonylamino)hexanoylamino]hexanoate (PubChem CID 91729869) has the molecular formula C23H44N2O5 and a molecular weight of 428.61 g/mol. Its IUPAC name is 4-methylpentyl 2-[2-(butoxycarbonylamino)hexanoylamino]hexanoate.
| Compound Name | 4-methylpentyl 2-[2-(butoxycarbonylamino)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 91729869 |
| Molecular Formula | C23H44N2O5 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 4-methylpentyl 2-[2-(butoxycarbonylamino)hexanoylamino]hexanoate |
| SMILES | CCCCOC(=O)NC(CCCC)C(=O)NC(CCCC)C(=O)OCCCC(C)C |
| InChI | InChI=1S/C23H44N2O5/c1-6-9-14-19(25-23(28)30-16-11-8-3)21(26)24-20(15-10-7-2)22(27)29-17-12-13-18(4)5/h18-20H,6-17H2,1-5H3,(H,24,26)(H,25,28) |
| InChIKey | AOKBFUWNGVJQFN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|