C17H32N2O5 — CID 91718605
propyl 2-[2-(methoxycarbonylamino)hexanoylamino]hexanoate (PubChem CID 91718605) has the molecular formula C17H32N2O5 and a molecular weight of 344.45 g/mol. Its IUPAC name is propyl 2-[2-(methoxycarbonylamino)hexanoylamino]hexanoate.
| Compound Name | propyl 2-[2-(methoxycarbonylamino)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 91718605 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | propyl 2-[2-(methoxycarbonylamino)hexanoylamino]hexanoate |
| SMILES | CCCCC(NC(=O)OC)C(=O)NC(CCCC)C(=O)OCCC |
| InChI | InChI=1S/C17H32N2O5/c1-5-8-10-13(19-17(22)23-4)15(20)18-14(11-9-6-2)16(21)24-12-7-3/h13-14H,5-12H2,1-4H3,(H,18,20)(H,19,22) |
| InChIKey | VGZDVNQPQKMROU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |