C20H38N2O6 — CID 91726640
4-methylpentyl 2-[2-(2-methoxyethoxycarbonylamino)pentanoylamino]pentanoate (PubChem CID 91726640) has the molecular formula C20H38N2O6 and a molecular weight of 402.53 g/mol. Its IUPAC name is 4-methylpentyl 2-[2-(2-methoxyethoxycarbonylamino)pentanoylamino]pentanoate.
| Compound Name | 4-methylpentyl 2-[2-(2-methoxyethoxycarbonylamino)pentanoylamino]pentanoate |
|---|---|
| PubChem CID | 91726640 |
| Molecular Formula | C20H38N2O6 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 4-methylpentyl 2-[2-(2-methoxyethoxycarbonylamino)pentanoylamino]pentanoate |
| SMILES | CCCC(NC(=O)OCCOC)C(=O)NC(CCC)C(=O)OCCCC(C)C |
| InChI | InChI=1S/C20H38N2O6/c1-6-9-16(22-20(25)28-14-13-26-5)18(23)21-17(10-7-2)19(24)27-12-8-11-15(3)4/h15-17H,6-14H2,1-5H3,(H,21,23)(H,22,25) |
| InChIKey | KTGGNLWGRCGSFJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|