C9H11N3O3 — CID 64895452
3-amino-4-oxo-4-(pyridin-2-ylamino)butanoic acid (PubChem CID 64895452) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-amino-4-oxo-4-(pyridin-2-ylamino)butanoic acid.
| Compound Name | 3-amino-4-oxo-4-(pyridin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 64895452 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-amino-4-oxo-4-(pyridin-2-ylamino)butanoic acid |
| SMILES | NC(CC(=O)O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C9H11N3O3/c10-6(5-8(13)14)9(15)12-7-3-1-2-4-11-7/h1-4,6H,5,10H2,(H,13,14)(H,11,12,15) |
| InChIKey | IENMZJMWVPLIJB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |