C33H36N4O4 — CID 70796481
butyl N-[1-[(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)amino]-1-oxo-4-phenylbutan-2-yl]carbamate (PubChem CID 70796481) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is butyl N-[1-[(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)amino]-1-oxo-4-phenylbutan-2-yl]carbamate.
| Compound Name | butyl N-[1-[(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)amino]-1-oxo-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70796481 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | butyl N-[1-[(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)amino]-1-oxo-4-phenylbutan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(CCc1ccccc1)C(=O)NC(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C33H36N4O4/c1-2-3-22-41-32(39)36-29(19-18-25-12-6-4-7-13-25)31(38)37-30(26-14-8-5-9-15-26)33(40,27-16-10-20-34-23-27)28-17-11-21-35-24-28/h4-17,20-21,23-24,29-30,40H,2-3,18-19,22H2,1H3,(H,36,39)(H,37,38) |
| InChIKey | YYGTZEJSIYHAMM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|