C20H21N3O — CID 66962752
2-(ethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol (PubChem CID 66962752) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-(ethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol.
| Compound Name | 2-(ethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol |
|---|---|
| PubChem CID | 66962752 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-(ethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol |
| SMILES | CCNC(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C20H21N3O/c1-2-23-19(16-8-4-3-5-9-16)20(24,17-10-6-12-21-14-17)18-11-7-13-22-15-18/h3-15,19,23-24H,2H2,1H3 |
| InChIKey | LFRKQCJQYAHEQT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |