C26H23N3O3 — CID 77212044
N-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)-3-methoxybenzamide (PubChem CID 77212044) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)-3-methoxybenzamide.
| Compound Name | N-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 77212044 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-(2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(c2ccccc2)C(O)(c2cccnc2)c2cccnc2)c1 |
| InChI | InChI=1S/C26H23N3O3/c1-32-23-13-5-10-20(16-23)25(30)29-24(19-8-3-2-4-9-19)26(31,21-11-6-14-27-17-21)22-12-7-15-28-18-22/h2-18,24,31H,1H3,(H,29,30) |
| InChIKey | YUCLHQJEAOZGLS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |