C27H25N3O3 — CID 57425636
N-[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]-2-phenylmethoxyacetamide (PubChem CID 57425636) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]-2-phenylmethoxyacetamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 57425636 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenyl-2,2-dipyridin-3-ylethyl]-2-phenylmethoxyacetamide |
| SMILES | O=C(COCc1ccccc1)N[C@H](c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C27H25N3O3/c31-25(20-33-19-21-9-3-1-4-10-21)30-26(22-11-5-2-6-12-22)27(32,23-13-7-15-28-17-23)24-14-8-16-29-18-24/h1-18,26,32H,19-20H2,(H,30,31)/t26-/m1/s1 |
| InChIKey | UGRFKRJFUGGWLR-AREMUKBSSA-N |
| XLogP | 3.79 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |